C20H17ClN2O4S — CID 1209412
2-[5-[(5-chloro-2-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3,4-dimethylphenyl)acetamide (PubChem CID 1209412) has the molecular formula C20H17ClN2O4S and a molecular weight of 416.89 g/mol. Its IUPAC name is 2-[5-[(5-chloro-2-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3,4-dimethylphenyl)acetamide.
| Compound Name | 2-[5-[(5-chloro-2-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 1209412 |
| Molecular Formula | C20H17ClN2O4S |
| Molecular Weight | 416.89 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | 2-[5-[(5-chloro-2-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3,4-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CN2C(=O)SC(=Cc3cc(Cl)ccc3O)C2=O)cc1C |
| InChI | InChI=1S/C20H17ClN2O4S/c1-11-3-5-15(7-12(11)2)22-18(25)10-23-19(26)17(28-20(23)27)9-13-8-14(21)4-6-16(13)24/h3-9,24H,10H2,1-2H3,(H,22,25) |
| InChIKey | VAMUAJMNEPYWCH-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.89 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|