C18H27Cl2N5OS — CID 120941815
(3R,4S)-N-methyl-4-(1-methylpyrazol-4-yl)-N-(2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-yl)pyrrolidine-3-carboxamide;dihydrochloride (PubChem CID 120941815) has the molecular formula C18H27Cl2N5OS and a molecular weight of 432.42 g/mol. Its IUPAC name is (3R,4S)-N-methyl-4-(1-methylpyrazol-4-yl)-N-(2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-yl)pyrrolidine-3-carboxamide;dihydrochloride.
| Compound Name | (3R,4S)-N-methyl-4-(1-methylpyrazol-4-yl)-N-(2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-yl)pyrrolidine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 120941815 |
| Molecular Formula | C18H27Cl2N5OS |
| Molecular Weight | 432.42 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | (3R,4S)-N-methyl-4-(1-methylpyrazol-4-yl)-N-(2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-yl)pyrrolidine-3-carboxamide;dihydrochloride |
| SMILES | Cc1nc2c(s1)C(N(C)C(=O)[C@H]1CNC[C@@H]1c1cnn(C)c1)CCC2.Cl.Cl |
| InChI | InChI=1S/C18H25N5OS.2ClH/c1-11-21-15-5-4-6-16(17(15)25-11)23(3)18(24)14-9-19-8-13(14)12-7-20-22(2)10-12;;/h7,10,13-14,16,19H,4-6,8-9H2,1-3H3;2*1H/t13-,14+,16?;;/m1../s1 |
| InChIKey | OCFMIWJYDSNJKE-RRZQRTTDSA-N |
| XLogP | 2.87 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |