C13H21F4N3O2 — CID 120941906
[(2R,3S)-2-methylmorpholin-3-yl]-[4-(2,2,3,3-tetrafluoropropyl)piperazin-1-yl]methanone (PubChem CID 120941906) has the molecular formula C13H21F4N3O2 and a molecular weight of 327.32 g/mol. Its IUPAC name is [(2R,3S)-2-methylmorpholin-3-yl]-[4-(2,2,3,3-tetrafluoropropyl)piperazin-1-yl]methanone.
| Compound Name | [(2R,3S)-2-methylmorpholin-3-yl]-[4-(2,2,3,3-tetrafluoropropyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 120941906 |
| Molecular Formula | C13H21F4N3O2 |
| Molecular Weight | 327.32 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | [(2R,3S)-2-methylmorpholin-3-yl]-[4-(2,2,3,3-tetrafluoropropyl)piperazin-1-yl]methanone |
| SMILES | C[C@H]1OCCN[C@@H]1C(=O)N1CCN(CC(F)(F)C(F)F)CC1 |
| InChI | InChI=1S/C13H21F4N3O2/c1-9-10(18-2-7-22-9)11(21)20-5-3-19(4-6-20)8-13(16,17)12(14)15/h9-10,12,18H,2-8H2,1H3/t9-,10+/m1/s1 |
| InChIKey | IDVOXISFBTVCDG-ZJUUUORDSA-N |
| XLogP | 0.41 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.32 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|