C14H20Cl2N2O3 — CID 120944491
2-(2-chlorophenoxy)-N-[(4-hydroxypyrrolidin-3-yl)methyl]propanamide;hydrochloride (PubChem CID 120944491) has the molecular formula C14H20Cl2N2O3 and a molecular weight of 335.23 g/mol. Its IUPAC name is 2-(2-chlorophenoxy)-N-[(4-hydroxypyrrolidin-3-yl)methyl]propanamide;hydrochloride.
| Compound Name | 2-(2-chlorophenoxy)-N-[(4-hydroxypyrrolidin-3-yl)methyl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 120944491 |
| Molecular Formula | C14H20Cl2N2O3 |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 2-(2-chlorophenoxy)-N-[(4-hydroxypyrrolidin-3-yl)methyl]propanamide;hydrochloride |
| SMILES | CC(Oc1ccccc1Cl)C(=O)NCC1CNCC1O.Cl |
| InChI | InChI=1S/C14H19ClN2O3.ClH/c1-9(20-13-5-3-2-4-11(13)15)14(19)17-7-10-6-16-8-12(10)18;/h2-5,9-10,12,16,18H,6-8H2,1H3,(H,17,19);1H |
| InChIKey | LHYNZOLQXZQQIL-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |