C16H18N4O3 — CID 120944668
N-[(4-hydroxypyrrolidin-3-yl)methyl]-2-oxo-6-pyridin-2-yl-1H-pyridine-3-carboxamide (PubChem CID 120944668) has the molecular formula C16H18N4O3 and a molecular weight of 314.34 g/mol. Its IUPAC name is N-[(4-hydroxypyrrolidin-3-yl)methyl]-2-oxo-6-pyridin-2-yl-1H-pyridine-3-carboxamide.
| Compound Name | N-[(4-hydroxypyrrolidin-3-yl)methyl]-2-oxo-6-pyridin-2-yl-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 120944668 |
| Molecular Formula | C16H18N4O3 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | N-[(4-hydroxypyrrolidin-3-yl)methyl]-2-oxo-6-pyridin-2-yl-1H-pyridine-3-carboxamide |
| SMILES | O=C(NCC1CNCC1O)c1ccc(-c2ccccn2)[nH]c1=O |
| InChI | InChI=1S/C16H18N4O3/c21-14-9-17-7-10(14)8-19-15(22)11-4-5-13(20-16(11)23)12-3-1-2-6-18-12/h1-6,10,14,17,21H,7-9H2,(H,19,22)(H,20,23) |
| InChIKey | BAMKEZNZACJGTQ-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |