C16H18N4O3S — CID 120945879
N-[2-[(4-hydroxypyrrolidin-3-yl)methylcarbamoyl]thiophen-3-yl]pyridine-4-carboxamide (PubChem CID 120945879) has the molecular formula C16H18N4O3S and a molecular weight of 346.41 g/mol. Its IUPAC name is N-[2-[(4-hydroxypyrrolidin-3-yl)methylcarbamoyl]thiophen-3-yl]pyridine-4-carboxamide.
| Compound Name | N-[2-[(4-hydroxypyrrolidin-3-yl)methylcarbamoyl]thiophen-3-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 120945879 |
| Molecular Formula | C16H18N4O3S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | N-[2-[(4-hydroxypyrrolidin-3-yl)methylcarbamoyl]thiophen-3-yl]pyridine-4-carboxamide |
| SMILES | O=C(Nc1ccsc1C(=O)NCC1CNCC1O)c1ccncc1 |
| InChI | InChI=1S/C16H18N4O3S/c21-13-9-18-7-11(13)8-19-16(23)14-12(3-6-24-14)20-15(22)10-1-4-17-5-2-10/h1-6,11,13,18,21H,7-9H2,(H,19,23)(H,20,22) |
| InChIKey | BHSFONBPCBWJHN-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 103.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |