C17H20N4O2S — CID 120598578
N-[2-[(2-methylpiperidin-4-yl)carbamoyl]thiophen-3-yl]pyridine-4-carboxamide (PubChem CID 120598578) has the molecular formula C17H20N4O2S and a molecular weight of 344.44 g/mol. Its IUPAC name is N-[2-[(2-methylpiperidin-4-yl)carbamoyl]thiophen-3-yl]pyridine-4-carboxamide.
| Compound Name | N-[2-[(2-methylpiperidin-4-yl)carbamoyl]thiophen-3-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 120598578 |
| Molecular Formula | C17H20N4O2S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | N-[2-[(2-methylpiperidin-4-yl)carbamoyl]thiophen-3-yl]pyridine-4-carboxamide |
| SMILES | CC1CC(NC(=O)c2sccc2NC(=O)c2ccncc2)CCN1 |
| InChI | InChI=1S/C17H20N4O2S/c1-11-10-13(4-8-19-11)20-17(23)15-14(5-9-24-15)21-16(22)12-2-6-18-7-3-12/h2-3,5-7,9,11,13,19H,4,8,10H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | OMWIGEBAMAMOBR-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |