C15H16N4O2S — CID 119412807
N-[2-[(3R)-3-aminopyrrolidine-1-carbonyl]thiophen-3-yl]pyridine-4-carboxamide (PubChem CID 119412807) has the molecular formula C15H16N4O2S and a molecular weight of 316.39 g/mol. Its IUPAC name is N-[2-[(3R)-3-aminopyrrolidine-1-carbonyl]thiophen-3-yl]pyridine-4-carboxamide.
| Compound Name | N-[2-[(3R)-3-aminopyrrolidine-1-carbonyl]thiophen-3-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 119412807 |
| Molecular Formula | C15H16N4O2S |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | N-[2-[(3R)-3-aminopyrrolidine-1-carbonyl]thiophen-3-yl]pyridine-4-carboxamide |
| SMILES | N[C@@H]1CCN(C(=O)c2sccc2NC(=O)c2ccncc2)C1 |
| InChI | InChI=1S/C15H16N4O2S/c16-11-3-7-19(9-11)15(21)13-12(4-8-22-13)18-14(20)10-1-5-17-6-2-10/h1-2,4-6,8,11H,3,7,9,16H2,(H,18,20)/t11-/m1/s1 |
| InChIKey | RJBMGDGQZHYUAG-LLVKDONJSA-N |
| XLogP | 1.57 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |