About 1-[1-(4,4-difluoropyrrolidine-2-carbonyl)piperidin-4-yl]piperidin-2-one
1-[1-(4,4-difluoropyrrolidine-2-carbonyl)piperidin-4-yl]piperidin-2-one (PubChem CID 120954972) has the molecular formula C15H23F2N3O2
and a molecular weight of 315.36 g/mol. Its IUPAC name is 1-[1-(4,4-difluoropyrrolidine-2-carbonyl)piperidin-4-yl]piperidin-2-one.
Molecular Properties
| Compound Name | 1-[1-(4,4-difluoropyrrolidine-2-carbonyl)piperidin-4-yl]piperidin-2-one |
| PubChem CID | 120954972 |
| Molecular Formula | C15H23F2N3O2 |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 1-[1-(4,4-difluoropyrrolidine-2-carbonyl)piperidin-4-yl]piperidin-2-one |
| SMILES | O=C(C1CC(F)(F)CN1)N1CCC(N2CCCCC2=O)CC1 |
| InChI | InChI=1S/C15H23F2N3O2/c16-15(17)9-12(18-10-15)14(22)19-7-4-11(5-8-19)20-6-2-1-3-13(20)21/h11-12,18H,1-10H2 |
| InChIKey | XHRJSLXNXWDJAI-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[1-(4,4-difluoropyrrolidine-2-carbonyl)piperidin-4-yl]piperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(4,4-difluoropyrrolidine-2-carbonyl)piperidin-4-yl]piperidin-2-one?
The IUPAC name of 1-[1-(4,4-difluoropyrrolidine-2-carbonyl)piperidin-4-yl]piperidin-2-one (CID 120954972) is 1-[1-(4,4-difluoropyrrolidine-2-carbonyl)piperidin-4-yl]piperidin-2-one.
What is the SMILES notation for 1-[1-(4,4-difluoropyrrolidine-2-carbonyl)piperidin-4-yl]piperidin-2-one?
The canonical SMILES for 1-[1-(4,4-difluoropyrrolidine-2-carbonyl)piperidin-4-yl]piperidin-2-one is O=C(C1CC(F)(F)CN1)N1CCC(N2CCCCC2=O)CC1.
What is the InChIKey of 1-[1-(4,4-difluoropyrrolidine-2-carbonyl)piperidin-4-yl]piperidin-2-one?
The InChIKey is XHRJSLXNXWDJAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23F2N3O2/c16-15(17)9-12(18-10-15)14(22)19-7-4-11(5-8-19)20-6-2-1-3-13(20)21/h11-12,18H,1-10H2.
What are the key properties of 1-[1-(4,4-difluoropyrrolidine-2-carbonyl)piperidin-4-yl]piperidin-2-one?
1-[1-(4,4-difluoropyrrolidine-2-carbonyl)piperidin-4-yl]piperidin-2-one has a molecular weight of 315.36 g/mol, XLogP of 0.99, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(4,4-difluoropyrrolidine-2-carbonyl)piperidin-4-yl]piperidin-2-one is sourced from PubChem (CID 120954972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).