C14H17Cl3F2N2O2 — CID 120955458
N-[2-[(2,4-dichlorophenyl)methoxy]ethyl]-4,4-difluoropyrrolidine-2-carboxamide;hydrochloride (PubChem CID 120955458) has the molecular formula C14H17Cl3F2N2O2 and a molecular weight of 389.66 g/mol. Its IUPAC name is N-[2-[(2,4-dichlorophenyl)methoxy]ethyl]-4,4-difluoropyrrolidine-2-carboxamide;hydrochloride.
| Compound Name | N-[2-[(2,4-dichlorophenyl)methoxy]ethyl]-4,4-difluoropyrrolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120955458 |
| Molecular Formula | C14H17Cl3F2N2O2 |
| Molecular Weight | 389.66 g/mol |
| Exact Mass | 388.03 |
| IUPAC Name | N-[2-[(2,4-dichlorophenyl)methoxy]ethyl]-4,4-difluoropyrrolidine-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCCOCc1ccc(Cl)cc1Cl)C1CC(F)(F)CN1 |
| InChI | InChI=1S/C14H16Cl2F2N2O2.ClH/c15-10-2-1-9(11(16)5-10)7-22-4-3-19-13(21)12-6-14(17,18)8-20-12;/h1-2,5,12,20H,3-4,6-8H2,(H,19,21);1H |
| InChIKey | MIKBNMPWHXYOCD-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.66 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|