C13H23ClN4O2 — CID 120956363
5-(1-but-3-enoxyethyl)-3-(1-methylpiperazin-2-yl)-1,2,4-oxadiazole;hydrochloride (PubChem CID 120956363) has the molecular formula C13H23ClN4O2 and a molecular weight of 302.81 g/mol. Its IUPAC name is 5-(1-but-3-enoxyethyl)-3-(1-methylpiperazin-2-yl)-1,2,4-oxadiazole;hydrochloride.
| Compound Name | 5-(1-but-3-enoxyethyl)-3-(1-methylpiperazin-2-yl)-1,2,4-oxadiazole;hydrochloride |
|---|---|
| PubChem CID | 120956363 |
| Molecular Formula | C13H23ClN4O2 |
| Molecular Weight | 302.81 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 5-(1-but-3-enoxyethyl)-3-(1-methylpiperazin-2-yl)-1,2,4-oxadiazole;hydrochloride |
| SMILES | C=CCCOC(C)c1nc(C2CNCCN2C)no1.Cl |
| InChI | InChI=1S/C13H22N4O2.ClH/c1-4-5-8-18-10(2)13-15-12(16-19-13)11-9-14-6-7-17(11)3;/h4,10-11,14H,1,5-9H2,2-3H3;1H |
| InChIKey | CMGXYCOMFNKGQF-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 63.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.81 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|