C9H12F4N4O — CID 120956490
3-(1-methylpiperazin-2-yl)-5-(1,1,2,2-tetrafluoroethyl)-1,2,4-oxadiazole (PubChem CID 120956490) has the molecular formula C9H12F4N4O and a molecular weight of 268.21 g/mol. Its IUPAC name is 3-(1-methylpiperazin-2-yl)-5-(1,1,2,2-tetrafluoroethyl)-1,2,4-oxadiazole.
| Compound Name | 3-(1-methylpiperazin-2-yl)-5-(1,1,2,2-tetrafluoroethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 120956490 |
| Molecular Formula | C9H12F4N4O |
| Molecular Weight | 268.21 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 3-(1-methylpiperazin-2-yl)-5-(1,1,2,2-tetrafluoroethyl)-1,2,4-oxadiazole |
| SMILES | CN1CCNCC1c1noc(C(F)(F)C(F)F)n1 |
| InChI | InChI=1S/C9H12F4N4O/c1-17-3-2-14-4-5(17)6-15-8(18-16-6)9(12,13)7(10)11/h5,7,14H,2-4H2,1H3 |
| InChIKey | OCZWAPCTPOWKHD-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 54.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.21 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|