C29H27N5O3S — CID 1209572
4-[3-[(Z)-[2,4-dioxo-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzonitrile (PubChem CID 1209572) has the molecular formula C29H27N5O3S and a molecular weight of 525.63 g/mol. Its IUPAC name is 4-[3-[(Z)-[2,4-dioxo-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzonitrile.
| Compound Name | 4-[3-[(Z)-[2,4-dioxo-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzonitrile |
|---|---|
| PubChem CID | 1209572 |
| Molecular Formula | C29H27N5O3S |
| Molecular Weight | 525.63 g/mol |
| Exact Mass | 525.18 |
| IUPAC Name | 4-[3-[(Z)-[2,4-dioxo-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzonitrile |
| SMILES | Cc1cc(/C=C2\SC(=O)N(CC(=O)N3CCN(c4ccccc4)CC3)C2=O)c(C)n1-c1ccc(C#N)cc1 |
| InChI | InChI=1S/C29H27N5O3S/c1-20-16-23(21(2)34(20)25-10-8-22(18-30)9-11-25)17-26-28(36)33(29(37)38-26)19-27(35)32-14-12-31(13-15-32)24-6-4-3-5-7-24/h3-11,16-17H,12-15,19H2,1-2H3/b26-17- |
| InChIKey | VNIRPOOYWYSDFK-ONUIUJJFSA-N |
| XLogP | 4.35 |
| TPSA | 89.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.63 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|