C33H29N3O3S — CID 126389193
(5E)-3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-5-[[2,5-dimethyl-1-(4-phenylphenyl)pyrrol-3-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 126389193) has the molecular formula C33H29N3O3S and a molecular weight of 547.68 g/mol. Its IUPAC name is (5E)-3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-5-[[2,5-dimethyl-1-(4-phenylphenyl)pyrrol-3-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-5-[[2,5-dimethyl-1-(4-phenylphenyl)pyrrol-3-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126389193 |
| Molecular Formula | C33H29N3O3S |
| Molecular Weight | 547.68 g/mol |
| Exact Mass | 547.19 |
| IUPAC Name | (5E)-3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-5-[[2,5-dimethyl-1-(4-phenylphenyl)pyrrol-3-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1cc(/C=C2/SC(=O)N(CC(=O)N3CCc4ccccc4C3)C2=O)c(C)n1-c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C33H29N3O3S/c1-22-18-28(23(2)36(22)29-14-12-26(13-15-29)24-8-4-3-5-9-24)19-30-32(38)35(33(39)40-30)21-31(37)34-17-16-25-10-6-7-11-27(25)20-34/h3-15,18-19H,16-17,20-21H2,1-2H3/b30-19+ |
| InChIKey | DJODCXCESLYLST-NDZAJKAJSA-N |
| XLogP | 6.38 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.68 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|