C27H26N4O5S2 — CID 126392292
4-[3-[(Z)-[3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzenesulfonamide (PubChem CID 126392292) has the molecular formula C27H26N4O5S2 and a molecular weight of 550.66 g/mol. Its IUPAC name is 4-[3-[(Z)-[3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzenesulfonamide.
| Compound Name | 4-[3-[(Z)-[3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 126392292 |
| Molecular Formula | C27H26N4O5S2 |
| Molecular Weight | 550.66 g/mol |
| Exact Mass | 550.13 |
| IUPAC Name | 4-[3-[(Z)-[3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]benzenesulfonamide |
| SMILES | Cc1cc(/C=C2\SC(=O)N(CC(=O)N3CCc4ccccc4C3)C2=O)c(C)n1-c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C27H26N4O5S2/c1-17-13-21(18(2)31(17)22-7-9-23(10-8-22)38(28,35)36)14-24-26(33)30(27(34)37-24)16-25(32)29-12-11-19-5-3-4-6-20(19)15-29/h3-10,13-14H,11-12,15-16H2,1-2H3,(H2,28,35,36)/b24-14- |
| InChIKey | QAVHIOBMIWOUPY-OYKKKHCWSA-N |
| XLogP | 3.36 |
| TPSA | 122.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.66 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|