C19H28N4O3 — CID 120958144
5-(3,4-dipropoxyphenyl)-3-(1-methylpiperazin-2-yl)-1,2,4-oxadiazole (PubChem CID 120958144) has the molecular formula C19H28N4O3 and a molecular weight of 360.46 g/mol. Its IUPAC name is 5-(3,4-dipropoxyphenyl)-3-(1-methylpiperazin-2-yl)-1,2,4-oxadiazole.
| Compound Name | 5-(3,4-dipropoxyphenyl)-3-(1-methylpiperazin-2-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 120958144 |
| Molecular Formula | C19H28N4O3 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | 5-(3,4-dipropoxyphenyl)-3-(1-methylpiperazin-2-yl)-1,2,4-oxadiazole |
| SMILES | CCCOc1ccc(-c2nc(C3CNCCN3C)no2)cc1OCCC |
| InChI | InChI=1S/C19H28N4O3/c1-4-10-24-16-7-6-14(12-17(16)25-11-5-2)19-21-18(22-26-19)15-13-20-8-9-23(15)3/h6-7,12,15,20H,4-5,8-11,13H2,1-3H3 |
| InChIKey | FPSAYBQLOFBENR-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 72.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |