C13H19FN2O2 — CID 120965543
(2S,4R)-1-[2-(cyclohexen-1-yl)acetyl]-4-fluoropyrrolidine-2-carboxamide (PubChem CID 120965543) has the molecular formula C13H19FN2O2 and a molecular weight of 254.30 g/mol. Its IUPAC name is (2S,4R)-1-[2-(cyclohexen-1-yl)acetyl]-4-fluoropyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-1-[2-(cyclohexen-1-yl)acetyl]-4-fluoropyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 120965543 |
| Molecular Formula | C13H19FN2O2 |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | (2S,4R)-1-[2-(cyclohexen-1-yl)acetyl]-4-fluoropyrrolidine-2-carboxamide |
| SMILES | NC(=O)[C@@H]1C[C@@H](F)CN1C(=O)CC1=CCCCC1 |
| InChI | InChI=1S/C13H19FN2O2/c14-10-7-11(13(15)18)16(8-10)12(17)6-9-4-2-1-3-5-9/h4,10-11H,1-3,5-8H2,(H2,15,18)/t10-,11+/m1/s1 |
| InChIKey | RZSJCTCUPAEBJU-MNOVXSKESA-N |
| XLogP | 1.30 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|