C12H21N5O — CID 120965775
1,2-dimethyl-3-[[(2R,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]methyl]guanidine (PubChem CID 120965775) has the molecular formula C12H21N5O and a molecular weight of 251.33 g/mol. Its IUPAC name is 1,2-dimethyl-3-[[(2R,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]methyl]guanidine.
| Compound Name | 1,2-dimethyl-3-[[(2R,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]methyl]guanidine |
|---|---|
| PubChem CID | 120965775 |
| Molecular Formula | C12H21N5O |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 1,2-dimethyl-3-[[(2R,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]methyl]guanidine |
| SMILES | C/N=C(\NC)NC[C@@H]1CCO[C@H]1c1ccnn1C |
| InChI | InChI=1S/C12H21N5O/c1-13-12(14-2)15-8-9-5-7-18-11(9)10-4-6-16-17(10)3/h4,6,9,11H,5,7-8H2,1-3H3,(H2,13,14,15)/t9-,11+/m0/s1 |
| InChIKey | MHNYLJZRVXKBQS-GXSJLCMTSA-N |
| XLogP | 0.29 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|