About 5-bromo-N-[[(2R,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]methyl]pyrimidin-2-amine
5-bromo-N-[[(2R,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]methyl]pyrimidin-2-amine (PubChem CID 128992017) has the molecular formula C13H16BrN5O
and a molecular weight of 338.21 g/mol. Its IUPAC name is 5-bromo-N-[[(2R,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]methyl]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 5-bromo-N-[[(2R,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]methyl]pyrimidin-2-amine |
| PubChem CID | 128992017 |
| Molecular Formula | C13H16BrN5O |
| Molecular Weight | 338.21 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | 5-bromo-N-[[(2R,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]methyl]pyrimidin-2-amine |
| SMILES | Cn1nccc1[C@@H]1OCC[C@H]1CNc1ncc(Br)cn1 |
| InChI | InChI=1S/C13H16BrN5O/c1-19-11(2-4-18-19)12-9(3-5-20-12)6-15-13-16-7-10(14)8-17-13/h2,4,7-9,12H,3,5-6H2,1H3,(H,15,16,17)/t9-,12+/m0/s1 |
| InChIKey | ZWPYYZSZGXTORC-JOYOIKCWSA-N |
| XLogP | 2.16 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.21 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-bromo-N-[[(2R,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]methyl]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-[[(2R,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]methyl]pyrimidin-2-amine?
The IUPAC name of 5-bromo-N-[[(2R,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]methyl]pyrimidin-2-amine (CID 128992017) is 5-bromo-N-[[(2R,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]methyl]pyrimidin-2-amine.
What is the SMILES notation for 5-bromo-N-[[(2R,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]methyl]pyrimidin-2-amine?
The canonical SMILES for 5-bromo-N-[[(2R,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]methyl]pyrimidin-2-amine is Cn1nccc1[C@@H]1OCC[C@H]1CNc1ncc(Br)cn1.
What is the InChIKey of 5-bromo-N-[[(2R,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]methyl]pyrimidin-2-amine?
The InChIKey is ZWPYYZSZGXTORC-JOYOIKCWSA-N. The full InChI is InChI=1S/C13H16BrN5O/c1-19-11(2-4-18-19)12-9(3-5-20-12)6-15-13-16-7-10(14)8-17-13/h2,4,7-9,12H,3,5-6H2,1H3,(H,15,16,17)/t9-,12+/m0/s1.
What are the key properties of 5-bromo-N-[[(2R,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]methyl]pyrimidin-2-amine?
5-bromo-N-[[(2R,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]methyl]pyrimidin-2-amine has a molecular weight of 338.21 g/mol, XLogP of 2.16, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-[[(2R,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]methyl]pyrimidin-2-amine is sourced from PubChem (CID 128992017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).