C13H19BrClFN2O — CID 120966074
[1-[2-(3-bromo-5-fluorophenoxy)ethyl]pyrrolidin-3-yl]methanamine;hydrochloride (PubChem CID 120966074) has the molecular formula C13H19BrClFN2O and a molecular weight of 353.66 g/mol. Its IUPAC name is [1-[2-(3-bromo-5-fluorophenoxy)ethyl]pyrrolidin-3-yl]methanamine;hydrochloride.
| Compound Name | [1-[2-(3-bromo-5-fluorophenoxy)ethyl]pyrrolidin-3-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 120966074 |
| Molecular Formula | C13H19BrClFN2O |
| Molecular Weight | 353.66 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | [1-[2-(3-bromo-5-fluorophenoxy)ethyl]pyrrolidin-3-yl]methanamine;hydrochloride |
| SMILES | Cl.NCC1CCN(CCOc2cc(F)cc(Br)c2)C1 |
| InChI | InChI=1S/C13H18BrFN2O.ClH/c14-11-5-12(15)7-13(6-11)18-4-3-17-2-1-10(8-16)9-17;/h5-7,10H,1-4,8-9,16H2;1H |
| InChIKey | AIVVTFLCCOCQHU-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.66 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |