C13H18BrFN2 — CID 79706155
[1-[(3-bromo-5-fluorophenyl)methyl]piperidin-3-yl]methanamine (PubChem CID 79706155) has the molecular formula C13H18BrFN2 and a molecular weight of 301.20 g/mol. Its IUPAC name is [1-[(3-bromo-5-fluorophenyl)methyl]piperidin-3-yl]methanamine.
| Compound Name | [1-[(3-bromo-5-fluorophenyl)methyl]piperidin-3-yl]methanamine |
|---|---|
| PubChem CID | 79706155 |
| Molecular Formula | C13H18BrFN2 |
| Molecular Weight | 301.20 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | [1-[(3-bromo-5-fluorophenyl)methyl]piperidin-3-yl]methanamine |
| SMILES | NCC1CCCN(Cc2cc(F)cc(Br)c2)C1 |
| InChI | InChI=1S/C13H18BrFN2/c14-12-4-11(5-13(15)6-12)9-17-3-1-2-10(7-16)8-17/h4-6,10H,1-3,7-9,16H2 |
| InChIKey | QSMXXQDKLJRQHT-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.20 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |