C11H23ClF2N2O — CID 120966176
1-[1-[2-(2,2-difluoroethoxy)ethyl]piperidin-4-yl]-N-methylmethanamine;hydrochloride (PubChem CID 120966176) has the molecular formula C11H23ClF2N2O and a molecular weight of 272.77 g/mol. Its IUPAC name is 1-[1-[2-(2,2-difluoroethoxy)ethyl]piperidin-4-yl]-N-methylmethanamine;hydrochloride.
| Compound Name | 1-[1-[2-(2,2-difluoroethoxy)ethyl]piperidin-4-yl]-N-methylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 120966176 |
| Molecular Formula | C11H23ClF2N2O |
| Molecular Weight | 272.77 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 1-[1-[2-(2,2-difluoroethoxy)ethyl]piperidin-4-yl]-N-methylmethanamine;hydrochloride |
| SMILES | CNCC1CCN(CCOCC(F)F)CC1.Cl |
| InChI | InChI=1S/C11H22F2N2O.ClH/c1-14-8-10-2-4-15(5-3-10)6-7-16-9-11(12)13;/h10-11,14H,2-9H2,1H3;1H |
| InChIKey | WEMQYYMIYSFHJK-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.77 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|