C11H23F2N3O3S — CID 106091913
N-[2-(2,2-difluoroethoxy)ethyl]-3-(methylaminomethyl)piperidine-1-sulfonamide (PubChem CID 106091913) has the molecular formula C11H23F2N3O3S and a molecular weight of 315.39 g/mol. Its IUPAC name is N-[2-(2,2-difluoroethoxy)ethyl]-3-(methylaminomethyl)piperidine-1-sulfonamide.
| Compound Name | N-[2-(2,2-difluoroethoxy)ethyl]-3-(methylaminomethyl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 106091913 |
| Molecular Formula | C11H23F2N3O3S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | N-[2-(2,2-difluoroethoxy)ethyl]-3-(methylaminomethyl)piperidine-1-sulfonamide |
| SMILES | CNCC1CCCN(S(=O)(=O)NCCOCC(F)F)C1 |
| InChI | InChI=1S/C11H23F2N3O3S/c1-14-7-10-3-2-5-16(8-10)20(17,18)15-4-6-19-9-11(12)13/h10-11,14-15H,2-9H2,1H3 |
| InChIKey | ADFGRJTWQYBDRG-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|