C13H22BrN3O2S2 — CID 106095283
N-[2-(5-bromothiophen-2-yl)ethyl]-3-(methylaminomethyl)piperidine-1-sulfonamide (PubChem CID 106095283) has the molecular formula C13H22BrN3O2S2 and a molecular weight of 396.38 g/mol. Its IUPAC name is N-[2-(5-bromothiophen-2-yl)ethyl]-3-(methylaminomethyl)piperidine-1-sulfonamide.
| Compound Name | N-[2-(5-bromothiophen-2-yl)ethyl]-3-(methylaminomethyl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 106095283 |
| Molecular Formula | C13H22BrN3O2S2 |
| Molecular Weight | 396.38 g/mol |
| Exact Mass | 395.03 |
| IUPAC Name | N-[2-(5-bromothiophen-2-yl)ethyl]-3-(methylaminomethyl)piperidine-1-sulfonamide |
| SMILES | CNCC1CCCN(S(=O)(=O)NCCc2ccc(Br)s2)C1 |
| InChI | InChI=1S/C13H22BrN3O2S2/c1-15-9-11-3-2-8-17(10-11)21(18,19)16-7-6-12-4-5-13(14)20-12/h4-5,11,15-16H,2-3,6-10H2,1H3 |
| InChIKey | KSBNLWVBOVOBFS-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.38 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |