C11H15BrN2O4S2 — CID 61012712
1-[(5-bromothiophen-2-yl)methylsulfamoyl]piperidine-3-carboxylic acid (PubChem CID 61012712) has the molecular formula C11H15BrN2O4S2 and a molecular weight of 383.29 g/mol. Its IUPAC name is 1-[(5-bromothiophen-2-yl)methylsulfamoyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[(5-bromothiophen-2-yl)methylsulfamoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 61012712 |
| Molecular Formula | C11H15BrN2O4S2 |
| Molecular Weight | 383.29 g/mol |
| Exact Mass | 381.97 |
| IUPAC Name | 1-[(5-bromothiophen-2-yl)methylsulfamoyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCCN(S(=O)(=O)NCc2ccc(Br)s2)C1 |
| InChI | InChI=1S/C11H15BrN2O4S2/c12-10-4-3-9(19-10)6-13-20(17,18)14-5-1-2-8(7-14)11(15)16/h3-4,8,13H,1-2,5-7H2,(H,15,16) |
| InChIKey | HBVIBVVBYMIMNW-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.29 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |