C16H19N3O5S — CID 131949814
1-[(2-phenyl-1,3-oxazol-4-yl)methylsulfamoyl]piperidine-3-carboxylic acid (PubChem CID 131949814) has the molecular formula C16H19N3O5S and a molecular weight of 365.41 g/mol. Its IUPAC name is 1-[(2-phenyl-1,3-oxazol-4-yl)methylsulfamoyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[(2-phenyl-1,3-oxazol-4-yl)methylsulfamoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 131949814 |
| Molecular Formula | C16H19N3O5S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 1-[(2-phenyl-1,3-oxazol-4-yl)methylsulfamoyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCCN(S(=O)(=O)NCc2coc(-c3ccccc3)n2)C1 |
| InChI | InChI=1S/C16H19N3O5S/c20-16(21)13-7-4-8-19(10-13)25(22,23)17-9-14-11-24-15(18-14)12-5-2-1-3-6-12/h1-3,5-6,11,13,17H,4,7-10H2,(H,20,21) |
| InChIKey | IHRLLJVKVLXSJD-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 112.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |