C13H24N2O4S — CID 60858431
1-(cyclohexylmethylsulfamoyl)piperidine-3-carboxylic acid (PubChem CID 60858431) has the molecular formula C13H24N2O4S and a molecular weight of 304.41 g/mol. Its IUPAC name is 1-(cyclohexylmethylsulfamoyl)piperidine-3-carboxylic acid.
| Compound Name | 1-(cyclohexylmethylsulfamoyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 60858431 |
| Molecular Formula | C13H24N2O4S |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 1-(cyclohexylmethylsulfamoyl)piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCCN(S(=O)(=O)NCC2CCCCC2)C1 |
| InChI | InChI=1S/C13H24N2O4S/c16-13(17)12-7-4-8-15(10-12)20(18,19)14-9-11-5-2-1-3-6-11/h11-12,14H,1-10H2,(H,16,17) |
| InChIKey | YAXYEGQQXCYWIC-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |