C10H21N3O6S2 — CID 106334906
1-[3-(methanesulfonamido)propylsulfamoyl]piperidine-3-carboxylic acid (PubChem CID 106334906) has the molecular formula C10H21N3O6S2 and a molecular weight of 343.43 g/mol. Its IUPAC name is 1-[3-(methanesulfonamido)propylsulfamoyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[3-(methanesulfonamido)propylsulfamoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 106334906 |
| Molecular Formula | C10H21N3O6S2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 1-[3-(methanesulfonamido)propylsulfamoyl]piperidine-3-carboxylic acid |
| SMILES | CS(=O)(=O)NCCCNS(=O)(=O)N1CCCC(C(=O)O)C1 |
| InChI | InChI=1S/C10H21N3O6S2/c1-20(16,17)11-5-3-6-12-21(18,19)13-7-2-4-9(8-13)10(14)15/h9,11-12H,2-8H2,1H3,(H,14,15) |
| InChIKey | IVDUASQXIZFEPT-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|