C12H24N4O4S — CID 61403789
1-(2-piperazin-1-ylethylsulfamoyl)piperidine-3-carboxylic acid (PubChem CID 61403789) has the molecular formula C12H24N4O4S and a molecular weight of 320.42 g/mol. Its IUPAC name is 1-(2-piperazin-1-ylethylsulfamoyl)piperidine-3-carboxylic acid.
| Compound Name | 1-(2-piperazin-1-ylethylsulfamoyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 61403789 |
| Molecular Formula | C12H24N4O4S |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 1-(2-piperazin-1-ylethylsulfamoyl)piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCCN(S(=O)(=O)NCCN2CCNCC2)C1 |
| InChI | InChI=1S/C12H24N4O4S/c17-12(18)11-2-1-6-16(10-11)21(19,20)14-5-9-15-7-3-13-4-8-15/h11,13-14H,1-10H2,(H,17,18) |
| InChIKey | MVCZAPGRPBZYIP-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |