C11H18N2O4S2 — CID 114187438
1-(2-prop-2-ynylsulfanylethylsulfamoyl)piperidine-3-carboxylic acid (PubChem CID 114187438) has the molecular formula C11H18N2O4S2 and a molecular weight of 306.41 g/mol. Its IUPAC name is 1-(2-prop-2-ynylsulfanylethylsulfamoyl)piperidine-3-carboxylic acid.
| Compound Name | 1-(2-prop-2-ynylsulfanylethylsulfamoyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 114187438 |
| Molecular Formula | C11H18N2O4S2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 1-(2-prop-2-ynylsulfanylethylsulfamoyl)piperidine-3-carboxylic acid |
| SMILES | C#CCSCCNS(=O)(=O)N1CCCC(C(=O)O)C1 |
| InChI | InChI=1S/C11H18N2O4S2/c1-2-7-18-8-5-12-19(16,17)13-6-3-4-10(9-13)11(14)15/h1,10,12H,3-9H2,(H,14,15) |
| InChIKey | DGBXDLYKUOYOBX-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|