C13H26N2O5S — CID 115596236
1-(3-butoxypropylsulfamoyl)piperidine-3-carboxylic acid (PubChem CID 115596236) has the molecular formula C13H26N2O5S and a molecular weight of 322.43 g/mol. Its IUPAC name is 1-(3-butoxypropylsulfamoyl)piperidine-3-carboxylic acid.
| Compound Name | 1-(3-butoxypropylsulfamoyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 115596236 |
| Molecular Formula | C13H26N2O5S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | 1-(3-butoxypropylsulfamoyl)piperidine-3-carboxylic acid |
| SMILES | CCCCOCCCNS(=O)(=O)N1CCCC(C(=O)O)C1 |
| InChI | InChI=1S/C13H26N2O5S/c1-2-3-9-20-10-5-7-14-21(18,19)15-8-4-6-12(11-15)13(16)17/h12,14H,2-11H2,1H3,(H,16,17) |
| InChIKey | DTFHWLDYMXUHGG-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|