C14H22BrFN2O — CID 120966485
2-N-[2-(3-bromo-5-fluorophenoxy)ethyl]-2,3-dimethylbutane-1,2-diamine (PubChem CID 120966485) has the molecular formula C14H22BrFN2O and a molecular weight of 333.25 g/mol. Its IUPAC name is 2-N-[2-(3-bromo-5-fluorophenoxy)ethyl]-2,3-dimethylbutane-1,2-diamine.
| Compound Name | 2-N-[2-(3-bromo-5-fluorophenoxy)ethyl]-2,3-dimethylbutane-1,2-diamine |
|---|---|
| PubChem CID | 120966485 |
| Molecular Formula | C14H22BrFN2O |
| Molecular Weight | 333.25 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 2-N-[2-(3-bromo-5-fluorophenoxy)ethyl]-2,3-dimethylbutane-1,2-diamine |
| SMILES | CC(C)C(C)(CN)NCCOc1cc(F)cc(Br)c1 |
| InChI | InChI=1S/C14H22BrFN2O/c1-10(2)14(3,9-17)18-4-5-19-13-7-11(15)6-12(16)8-13/h6-8,10,18H,4-5,9,17H2,1-3H3 |
| InChIKey | ZLFQDVSXQLPOSY-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.25 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|