C14H23ClN2O — CID 119929206
2-N-[2-(3-chlorophenoxy)ethyl]-2,3-dimethylbutane-1,2-diamine (PubChem CID 119929206) has the molecular formula C14H23ClN2O and a molecular weight of 270.80 g/mol. Its IUPAC name is 2-N-[2-(3-chlorophenoxy)ethyl]-2,3-dimethylbutane-1,2-diamine.
| Compound Name | 2-N-[2-(3-chlorophenoxy)ethyl]-2,3-dimethylbutane-1,2-diamine |
|---|---|
| PubChem CID | 119929206 |
| Molecular Formula | C14H23ClN2O |
| Molecular Weight | 270.80 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 2-N-[2-(3-chlorophenoxy)ethyl]-2,3-dimethylbutane-1,2-diamine |
| SMILES | CC(C)C(C)(CN)NCCOc1cccc(Cl)c1 |
| InChI | InChI=1S/C14H23ClN2O/c1-11(2)14(3,10-16)17-7-8-18-13-6-4-5-12(15)9-13/h4-6,9,11,17H,7-8,10,16H2,1-3H3 |
| InChIKey | SJPLOQKBGGCUOX-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.80 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|