C13H21ClN2O — CID 112501140
4-(3-chlorophenoxy)-2-N,2-N,2-trimethylbutane-1,2-diamine (PubChem CID 112501140) has the molecular formula C13H21ClN2O and a molecular weight of 256.78 g/mol. Its IUPAC name is 4-(3-chlorophenoxy)-2-N,2-N,2-trimethylbutane-1,2-diamine.
| Compound Name | 4-(3-chlorophenoxy)-2-N,2-N,2-trimethylbutane-1,2-diamine |
|---|---|
| PubChem CID | 112501140 |
| Molecular Formula | C13H21ClN2O |
| Molecular Weight | 256.78 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 4-(3-chlorophenoxy)-2-N,2-N,2-trimethylbutane-1,2-diamine |
| SMILES | CN(C)C(C)(CN)CCOc1cccc(Cl)c1 |
| InChI | InChI=1S/C13H21ClN2O/c1-13(10-15,16(2)3)7-8-17-12-6-4-5-11(14)9-12/h4-6,9H,7-8,10,15H2,1-3H3 |
| InChIKey | LOQGAXJJRSSQCV-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.78 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |