C17H28F2N4O — CID 120967087
N-[2-(2,2-difluoroethoxy)ethyl]-N-[(1-ethylimidazol-2-yl)methyl]-6-azaspiro[2.5]octan-2-amine (PubChem CID 120967087) has the molecular formula C17H28F2N4O and a molecular weight of 342.43 g/mol. Its IUPAC name is N-[2-(2,2-difluoroethoxy)ethyl]-N-[(1-ethylimidazol-2-yl)methyl]-6-azaspiro[2.5]octan-2-amine.
| Compound Name | N-[2-(2,2-difluoroethoxy)ethyl]-N-[(1-ethylimidazol-2-yl)methyl]-6-azaspiro[2.5]octan-2-amine |
|---|---|
| PubChem CID | 120967087 |
| Molecular Formula | C17H28F2N4O |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | N-[2-(2,2-difluoroethoxy)ethyl]-N-[(1-ethylimidazol-2-yl)methyl]-6-azaspiro[2.5]octan-2-amine |
| SMILES | CCn1ccnc1CN(CCOCC(F)F)C1CC12CCNCC2 |
| InChI | InChI=1S/C17H28F2N4O/c1-2-22-8-7-21-16(22)12-23(9-10-24-13-15(18)19)14-11-17(14)3-5-20-6-4-17/h7-8,14-15,20H,2-6,9-13H2,1H3 |
| InChIKey | NGMZKQBUGUJIOW-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|