C16H24F2N2OS — CID 120967049
N-[2-(2,2-difluoroethoxy)ethyl]-N-(thiophen-3-ylmethyl)-6-azaspiro[2.5]octan-2-amine (PubChem CID 120967049) has the molecular formula C16H24F2N2OS and a molecular weight of 330.44 g/mol. Its IUPAC name is N-[2-(2,2-difluoroethoxy)ethyl]-N-(thiophen-3-ylmethyl)-6-azaspiro[2.5]octan-2-amine.
| Compound Name | N-[2-(2,2-difluoroethoxy)ethyl]-N-(thiophen-3-ylmethyl)-6-azaspiro[2.5]octan-2-amine |
|---|---|
| PubChem CID | 120967049 |
| Molecular Formula | C16H24F2N2OS |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | N-[2-(2,2-difluoroethoxy)ethyl]-N-(thiophen-3-ylmethyl)-6-azaspiro[2.5]octan-2-amine |
| SMILES | FC(F)COCCN(Cc1ccsc1)C1CC12CCNCC2 |
| InChI | InChI=1S/C16H24F2N2OS/c17-15(18)11-21-7-6-20(10-13-1-8-22-12-13)14-9-16(14)2-4-19-5-3-16/h1,8,12,14-15,19H,2-7,9-11H2 |
| InChIKey | QSLWDDLVRCVQTG-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|