C19H21FN2OS — CID 129465975
N-[(2R)-6-azaspiro[2.5]octan-2-yl]-4-fluoro-N-(thiophen-3-ylmethyl)benzamide (PubChem CID 129465975) has the molecular formula C19H21FN2OS and a molecular weight of 344.45 g/mol. Its IUPAC name is N-[(2R)-6-azaspiro[2.5]octan-2-yl]-4-fluoro-N-(thiophen-3-ylmethyl)benzamide.
| Compound Name | N-[(2R)-6-azaspiro[2.5]octan-2-yl]-4-fluoro-N-(thiophen-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 129465975 |
| Molecular Formula | C19H21FN2OS |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | N-[(2R)-6-azaspiro[2.5]octan-2-yl]-4-fluoro-N-(thiophen-3-ylmethyl)benzamide |
| SMILES | O=C(c1ccc(F)cc1)N(Cc1ccsc1)[C@@H]1CC12CCNCC2 |
| InChI | InChI=1S/C19H21FN2OS/c20-16-3-1-15(2-4-16)18(23)22(12-14-5-10-24-13-14)17-11-19(17)6-8-21-9-7-19/h1-5,10,13,17,21H,6-9,11-12H2/t17-/m1/s1 |
| InChIKey | TYLFICYPGVYCHE-QGZVFWFLSA-N |
| XLogP | 3.67 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |