C17H20ClN3OS — CID 128994657
N-(6-azaspiro[2.5]octan-2-yl)-4-chloro-N-(thiophen-3-ylmethyl)-1H-pyrrole-2-carboxamide (PubChem CID 128994657) has the molecular formula C17H20ClN3OS and a molecular weight of 349.89 g/mol. Its IUPAC name is N-(6-azaspiro[2.5]octan-2-yl)-4-chloro-N-(thiophen-3-ylmethyl)-1H-pyrrole-2-carboxamide.
| Compound Name | N-(6-azaspiro[2.5]octan-2-yl)-4-chloro-N-(thiophen-3-ylmethyl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 128994657 |
| Molecular Formula | C17H20ClN3OS |
| Molecular Weight | 349.89 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | N-(6-azaspiro[2.5]octan-2-yl)-4-chloro-N-(thiophen-3-ylmethyl)-1H-pyrrole-2-carboxamide |
| SMILES | O=C(c1cc(Cl)c[nH]1)N(Cc1ccsc1)C1CC12CCNCC2 |
| InChI | InChI=1S/C17H20ClN3OS/c18-13-7-14(20-9-13)16(22)21(10-12-1-6-23-11-12)15-8-17(15)2-4-19-5-3-17/h1,6-7,9,11,15,19-20H,2-5,8,10H2 |
| InChIKey | BOPOMDUMXNLDRQ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.89 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |