About 5-[(2,3-dimethylpiperazin-1-yl)methyl]-3-methyl-1,2-oxazole
5-[(2,3-dimethylpiperazin-1-yl)methyl]-3-methyl-1,2-oxazole (PubChem CID 120967134) has the molecular formula C11H19N3O
and a molecular weight of 209.29 g/mol. Its IUPAC name is 5-[(2,3-dimethylpiperazin-1-yl)methyl]-3-methyl-1,2-oxazole.
Molecular Properties
| Compound Name | 5-[(2,3-dimethylpiperazin-1-yl)methyl]-3-methyl-1,2-oxazole |
| PubChem CID | 120967134 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 5-[(2,3-dimethylpiperazin-1-yl)methyl]-3-methyl-1,2-oxazole |
| SMILES | Cc1cc(CN2CCNC(C)C2C)on1 |
| InChI | InChI=1S/C11H19N3O/c1-8-6-11(15-13-8)7-14-5-4-12-9(2)10(14)3/h6,9-10,12H,4-5,7H2,1-3H3 |
| InChIKey | MQIJKEQGLPZLCL-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(2,3-dimethylpiperazin-1-yl)methyl]-3-methyl-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2,3-dimethylpiperazin-1-yl)methyl]-3-methyl-1,2-oxazole?
The IUPAC name of 5-[(2,3-dimethylpiperazin-1-yl)methyl]-3-methyl-1,2-oxazole (CID 120967134) is 5-[(2,3-dimethylpiperazin-1-yl)methyl]-3-methyl-1,2-oxazole.
What is the SMILES notation for 5-[(2,3-dimethylpiperazin-1-yl)methyl]-3-methyl-1,2-oxazole?
The canonical SMILES for 5-[(2,3-dimethylpiperazin-1-yl)methyl]-3-methyl-1,2-oxazole is Cc1cc(CN2CCNC(C)C2C)on1.
What is the InChIKey of 5-[(2,3-dimethylpiperazin-1-yl)methyl]-3-methyl-1,2-oxazole?
The InChIKey is MQIJKEQGLPZLCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3O/c1-8-6-11(15-13-8)7-14-5-4-12-9(2)10(14)3/h6,9-10,12H,4-5,7H2,1-3H3.
What are the key properties of 5-[(2,3-dimethylpiperazin-1-yl)methyl]-3-methyl-1,2-oxazole?
5-[(2,3-dimethylpiperazin-1-yl)methyl]-3-methyl-1,2-oxazole has a molecular weight of 209.29 g/mol, XLogP of 1.17, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2,3-dimethylpiperazin-1-yl)methyl]-3-methyl-1,2-oxazole is sourced from PubChem (CID 120967134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).