C13H19N3O — CID 120970313
1-methyl-N-[2-(2-methylphenoxy)ethyl]-4,5-dihydroimidazol-2-amine (PubChem CID 120970313) has the molecular formula C13H19N3O and a molecular weight of 233.31 g/mol. Its IUPAC name is 1-methyl-N-[2-(2-methylphenoxy)ethyl]-4,5-dihydroimidazol-2-amine.
| Compound Name | 1-methyl-N-[2-(2-methylphenoxy)ethyl]-4,5-dihydroimidazol-2-amine |
|---|---|
| PubChem CID | 120970313 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | 1-methyl-N-[2-(2-methylphenoxy)ethyl]-4,5-dihydroimidazol-2-amine |
| SMILES | Cc1ccccc1OCCNC1=NCCN1C |
| InChI | InChI=1S/C13H19N3O/c1-11-5-3-4-6-12(11)17-10-8-15-13-14-7-9-16(13)2/h3-6H,7-10H2,1-2H3,(H,14,15) |
| InChIKey | IUALRSYIPULVBQ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|