C13H24IN3 — CID 120971424
N-(2-cyclohexylcyclopropyl)-1-methyl-4,5-dihydroimidazol-2-amine;hydroiodide (PubChem CID 120971424) has the molecular formula C13H24IN3 and a molecular weight of 349.26 g/mol. Its IUPAC name is N-(2-cyclohexylcyclopropyl)-1-methyl-4,5-dihydroimidazol-2-amine;hydroiodide.
| Compound Name | N-(2-cyclohexylcyclopropyl)-1-methyl-4,5-dihydroimidazol-2-amine;hydroiodide |
|---|---|
| PubChem CID | 120971424 |
| Molecular Formula | C13H24IN3 |
| Molecular Weight | 349.26 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | N-(2-cyclohexylcyclopropyl)-1-methyl-4,5-dihydroimidazol-2-amine;hydroiodide |
| SMILES | CN1CCN=C1NC1CC1C1CCCCC1.I |
| InChI | InChI=1S/C13H23N3.HI/c1-16-8-7-14-13(16)15-12-9-11(12)10-5-3-2-4-6-10;/h10-12H,2-9H2,1H3,(H,14,15);1H |
| InChIKey | DDAJXDRDWSGCIH-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.26 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|