C18H28N6O — CID 120972939
1-(furan-2-ylmethyl)-2-methyl-3-[[(2R,3S)-1-methyl-2-(2-methylpyrazol-3-yl)piperidin-3-yl]methyl]guanidine (PubChem CID 120972939) has the molecular formula C18H28N6O and a molecular weight of 344.46 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-2-methyl-3-[[(2R,3S)-1-methyl-2-(2-methylpyrazol-3-yl)piperidin-3-yl]methyl]guanidine.
| Compound Name | 1-(furan-2-ylmethyl)-2-methyl-3-[[(2R,3S)-1-methyl-2-(2-methylpyrazol-3-yl)piperidin-3-yl]methyl]guanidine |
|---|---|
| PubChem CID | 120972939 |
| Molecular Formula | C18H28N6O |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.23 |
| IUPAC Name | 1-(furan-2-ylmethyl)-2-methyl-3-[[(2R,3S)-1-methyl-2-(2-methylpyrazol-3-yl)piperidin-3-yl]methyl]guanidine |
| SMILES | C/N=C(\NCc1ccco1)NC[C@@H]1CCCN(C)[C@H]1c1ccnn1C |
| InChI | InChI=1S/C18H28N6O/c1-19-18(21-13-15-7-5-11-25-15)20-12-14-6-4-10-23(2)17(14)16-8-9-22-24(16)3/h5,7-9,11,14,17H,4,6,10,12-13H2,1-3H3,(H2,19,20,21)/t14-,17+/m0/s1 |
| InChIKey | NBNVUJSUFRPNKY-WMLDXEAASA-N |
| XLogP | 1.76 |
| TPSA | 70.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|