About N-[2-[[(1-methyl-4,5-dihydroimidazol-2-yl)amino]methyl]cyclohexyl]methanesulfonamide
N-[2-[[(1-methyl-4,5-dihydroimidazol-2-yl)amino]methyl]cyclohexyl]methanesulfonamide (PubChem CID 120973247) has the molecular formula C12H24N4O2S
and a molecular weight of 288.42 g/mol. Its IUPAC name is N-[2-[[(1-methyl-4,5-dihydroimidazol-2-yl)amino]methyl]cyclohexyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[2-[[(1-methyl-4,5-dihydroimidazol-2-yl)amino]methyl]cyclohexyl]methanesulfonamide |
| PubChem CID | 120973247 |
| Molecular Formula | C12H24N4O2S |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | N-[2-[[(1-methyl-4,5-dihydroimidazol-2-yl)amino]methyl]cyclohexyl]methanesulfonamide |
| SMILES | CN1CCN=C1NCC1CCCCC1NS(C)(=O)=O |
| InChI | InChI=1S/C12H24N4O2S/c1-16-8-7-13-12(16)14-9-10-5-3-4-6-11(10)15-19(2,17)18/h10-11,15H,3-9H2,1-2H3,(H,13,14) |
| InChIKey | DGTJRYQPASUCLD-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-[[(1-methyl-4,5-dihydroimidazol-2-yl)amino]methyl]cyclohexyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[[(1-methyl-4,5-dihydroimidazol-2-yl)amino]methyl]cyclohexyl]methanesulfonamide?
The IUPAC name of N-[2-[[(1-methyl-4,5-dihydroimidazol-2-yl)amino]methyl]cyclohexyl]methanesulfonamide (CID 120973247) is N-[2-[[(1-methyl-4,5-dihydroimidazol-2-yl)amino]methyl]cyclohexyl]methanesulfonamide.
What is the SMILES notation for N-[2-[[(1-methyl-4,5-dihydroimidazol-2-yl)amino]methyl]cyclohexyl]methanesulfonamide?
The canonical SMILES for N-[2-[[(1-methyl-4,5-dihydroimidazol-2-yl)amino]methyl]cyclohexyl]methanesulfonamide is CN1CCN=C1NCC1CCCCC1NS(C)(=O)=O.
What is the InChIKey of N-[2-[[(1-methyl-4,5-dihydroimidazol-2-yl)amino]methyl]cyclohexyl]methanesulfonamide?
The InChIKey is DGTJRYQPASUCLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N4O2S/c1-16-8-7-13-12(16)14-9-10-5-3-4-6-11(10)15-19(2,17)18/h10-11,15H,3-9H2,1-2H3,(H,13,14).
What are the key properties of N-[2-[[(1-methyl-4,5-dihydroimidazol-2-yl)amino]methyl]cyclohexyl]methanesulfonamide?
N-[2-[[(1-methyl-4,5-dihydroimidazol-2-yl)amino]methyl]cyclohexyl]methanesulfonamide has a molecular weight of 288.42 g/mol, XLogP of -0.01, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[[(1-methyl-4,5-dihydroimidazol-2-yl)amino]methyl]cyclohexyl]methanesulfonamide is sourced from PubChem (CID 120973247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).