C17H20FNO4 — CID 120976524
2-[[4-(3-fluorophenyl)oxan-4-yl]carbamoyl]cyclobutane-1-carboxylic acid (PubChem CID 120976524) has the molecular formula C17H20FNO4 and a molecular weight of 321.35 g/mol. Its IUPAC name is 2-[[4-(3-fluorophenyl)oxan-4-yl]carbamoyl]cyclobutane-1-carboxylic acid.
| Compound Name | 2-[[4-(3-fluorophenyl)oxan-4-yl]carbamoyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 120976524 |
| Molecular Formula | C17H20FNO4 |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 2-[[4-(3-fluorophenyl)oxan-4-yl]carbamoyl]cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC1C(=O)NC1(c2cccc(F)c2)CCOCC1 |
| InChI | InChI=1S/C17H20FNO4/c18-12-3-1-2-11(10-12)17(6-8-23-9-7-17)19-15(20)13-4-5-14(13)16(21)22/h1-3,10,13-14H,4-9H2,(H,19,20)(H,21,22) |
| InChIKey | LDLDBEIBPRCAND-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |