C20H20FNO5 — CID 119187111
2-[3-[[4-(3-fluorophenyl)oxan-4-yl]carbamoyl]phenoxy]acetic acid (PubChem CID 119187111) has the molecular formula C20H20FNO5 and a molecular weight of 373.38 g/mol. Its IUPAC name is 2-[3-[[4-(3-fluorophenyl)oxan-4-yl]carbamoyl]phenoxy]acetic acid.
| Compound Name | 2-[3-[[4-(3-fluorophenyl)oxan-4-yl]carbamoyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 119187111 |
| Molecular Formula | C20H20FNO5 |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 2-[3-[[4-(3-fluorophenyl)oxan-4-yl]carbamoyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1cccc(C(=O)NC2(c3cccc(F)c3)CCOCC2)c1 |
| InChI | InChI=1S/C20H20FNO5/c21-16-5-2-4-15(12-16)20(7-9-26-10-8-20)22-19(25)14-3-1-6-17(11-14)27-13-18(23)24/h1-6,11-12H,7-10,13H2,(H,22,25)(H,23,24) |
| InChIKey | JITWBSTZSXMBLB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |