C20H18N2O4 — CID 154788901
3-[[4-(3-cyanophenyl)oxan-4-yl]carbamoyl]benzoic acid (PubChem CID 154788901) has the molecular formula C20H18N2O4 and a molecular weight of 350.37 g/mol. Its IUPAC name is 3-[[4-(3-cyanophenyl)oxan-4-yl]carbamoyl]benzoic acid.
| Compound Name | 3-[[4-(3-cyanophenyl)oxan-4-yl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 154788901 |
| Molecular Formula | C20H18N2O4 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 3-[[4-(3-cyanophenyl)oxan-4-yl]carbamoyl]benzoic acid |
| SMILES | N#Cc1cccc(C2(NC(=O)c3cccc(C(=O)O)c3)CCOCC2)c1 |
| InChI | InChI=1S/C20H18N2O4/c21-13-14-3-1-6-17(11-14)20(7-9-26-10-8-20)22-18(23)15-4-2-5-16(12-15)19(24)25/h1-6,11-12H,7-10H2,(H,22,23)(H,24,25) |
| InChIKey | JZPVTTWIAVVMCD-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |