C18H20N4O2S — CID 126824836
N-[4-(3-cyanophenyl)oxan-4-yl]-2-(ethylamino)-1,3-thiazole-5-carboxamide (PubChem CID 126824836) has the molecular formula C18H20N4O2S and a molecular weight of 356.45 g/mol. Its IUPAC name is N-[4-(3-cyanophenyl)oxan-4-yl]-2-(ethylamino)-1,3-thiazole-5-carboxamide.
| Compound Name | N-[4-(3-cyanophenyl)oxan-4-yl]-2-(ethylamino)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 126824836 |
| Molecular Formula | C18H20N4O2S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | N-[4-(3-cyanophenyl)oxan-4-yl]-2-(ethylamino)-1,3-thiazole-5-carboxamide |
| SMILES | CCNc1ncc(C(=O)NC2(c3cccc(C#N)c3)CCOCC2)s1 |
| InChI | InChI=1S/C18H20N4O2S/c1-2-20-17-21-12-15(25-17)16(23)22-18(6-8-24-9-7-18)14-5-3-4-13(10-14)11-19/h3-5,10,12H,2,6-9H2,1H3,(H,20,21)(H,22,23) |
| InChIKey | YNFRIDDGFSNQTM-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |