C17H21F3N4O2 — CID 154801290
1-(4-amino-1,1,1-trifluorobutan-2-yl)-3-[4-(3-cyanophenyl)oxan-4-yl]urea (PubChem CID 154801290) has the molecular formula C17H21F3N4O2 and a molecular weight of 370.38 g/mol. Its IUPAC name is 1-(4-amino-1,1,1-trifluorobutan-2-yl)-3-[4-(3-cyanophenyl)oxan-4-yl]urea.
| Compound Name | 1-(4-amino-1,1,1-trifluorobutan-2-yl)-3-[4-(3-cyanophenyl)oxan-4-yl]urea |
|---|---|
| PubChem CID | 154801290 |
| Molecular Formula | C17H21F3N4O2 |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 1-(4-amino-1,1,1-trifluorobutan-2-yl)-3-[4-(3-cyanophenyl)oxan-4-yl]urea |
| SMILES | N#Cc1cccc(C2(NC(=O)NC(CCN)C(F)(F)F)CCOCC2)c1 |
| InChI | InChI=1S/C17H21F3N4O2/c18-17(19,20)14(4-7-21)23-15(25)24-16(5-8-26-9-6-16)13-3-1-2-12(10-13)11-22/h1-3,10,14H,4-9,21H2,(H2,23,24,25) |
| InChIKey | FAPXMBJSDGYAAX-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 100.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |