C16H21NO5S — CID 119186761
2-[3-[(4-methylsulfanyloxan-4-yl)methylcarbamoyl]phenoxy]acetic acid (PubChem CID 119186761) has the molecular formula C16H21NO5S and a molecular weight of 339.41 g/mol. Its IUPAC name is 2-[3-[(4-methylsulfanyloxan-4-yl)methylcarbamoyl]phenoxy]acetic acid.
| Compound Name | 2-[3-[(4-methylsulfanyloxan-4-yl)methylcarbamoyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 119186761 |
| Molecular Formula | C16H21NO5S |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 2-[3-[(4-methylsulfanyloxan-4-yl)methylcarbamoyl]phenoxy]acetic acid |
| SMILES | CSC1(CNC(=O)c2cccc(OCC(=O)O)c2)CCOCC1 |
| InChI | InChI=1S/C16H21NO5S/c1-23-16(5-7-21-8-6-16)11-17-15(20)12-3-2-4-13(9-12)22-10-14(18)19/h2-4,9H,5-8,10-11H2,1H3,(H,17,20)(H,18,19) |
| InChIKey | BGFWOABUMLTGAP-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |