C15H26ClN3OS — CID 120980871
1-piperazin-1-yl-3-[propan-2-yl(thiophen-2-ylmethyl)amino]propan-1-one;hydrochloride (PubChem CID 120980871) has the molecular formula C15H26ClN3OS and a molecular weight of 331.91 g/mol. Its IUPAC name is 1-piperazin-1-yl-3-[propan-2-yl(thiophen-2-ylmethyl)amino]propan-1-one;hydrochloride.
| Compound Name | 1-piperazin-1-yl-3-[propan-2-yl(thiophen-2-ylmethyl)amino]propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 120980871 |
| Molecular Formula | C15H26ClN3OS |
| Molecular Weight | 331.91 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 1-piperazin-1-yl-3-[propan-2-yl(thiophen-2-ylmethyl)amino]propan-1-one;hydrochloride |
| SMILES | CC(C)N(CCC(=O)N1CCNCC1)Cc1cccs1.Cl |
| InChI | InChI=1S/C15H25N3OS.ClH/c1-13(2)18(12-14-4-3-11-20-14)8-5-15(19)17-9-6-16-7-10-17;/h3-4,11,13,16H,5-10,12H2,1-2H3;1H |
| InChIKey | FPXMHRYKENEUHK-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.91 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |